Learn More
Thermo Scientific Chemicals MOPS, 99.5%, for molecular biology, Dnase, Rnase, Prot. free, for peptide sequencing
CAS: 1132-61-2 | C7H15NO4S | 209.26 g/mol
Marca: Thermo Scientific Chemicals 327661000
146.58 CHF valido fino al 2025-12-31
Usa il codice promo "25339" per avere il tuo prezzo promozionale.
Quantità | 100 g |
---|---|
Imballaggio | Glass bottle |
Descrizione
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological buffer
Identificatori chimici
1132-61-2 | |
209.26 | |
DVLFYONBTKHTER-UHFFFAOYSA-N | |
70807 | |
acido 3-morfolin-4-il-propano-1-solfonico |
C7H15NO4S | |
MFCD00006183 | |
3-(N-Morpholino)propanesulfonic acid | |
CHEBI:44115 | |
[O-]S(=O)(=O)CCC[NH+]1CCOCC1 |
Specifica
0.01 max. at 280nm | |
(0.1M aq. soln.) | |
1132-61-2 | |
99.4 | |
White | |
Powder | |
116°C | |
Authentic | |
C7H15NO4S | |
Glass bottle | |
3-(N-Morpholino)propanesulfonic acid | |
DVLFYONBTKHTER-UHFFFAOYSA-N | |
acido 3-morfolin-4-il-propano-1-solfonico | |
70807 | |
209.26 | |
Biologia molecolare |
MOPS | |
DNAse, RNAse and Protease Free | |
277.0°C to 282.0°C | |
100.0 | |
3.0 to 4.5 (1% soln. at 25°C) | |
100 g | |
99.50% | |
0.5% max. (105°C) | |
MFCD00006183 | |
15, 6352 | |
Solubility in water: 1000g/L (20°C). Other solubilities: <10g/L ethanol (20°C) | |
[O-]S(=O)(=O)CCC[NH+]1CCOCC1 | |
209.26 | |
CHEBI:44115 | |
99.5% |
Sicurezza e movimentazione
- MOPS
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.